Please wait...
-final-2.png){kind=logo}
Part # :CAN-CAN-KIT
Study Number :
Matrix :Multiple
Volume : 1 mL
Concentration :100 µg/mL
Units/Pack :1
Expiration : 365 Days / 12 Months
Storage Condition :Freezer
SDS :Safety Data Sheet
CAS Number :Multiple
Hazardous Info :
| Product | Shipping |
|---|---|
| Hazardous | Non-Hazardous |
This item has been deemed as hazardous.
Additional Hazardous shipping fees may apply.
Freezer Message: This item must be stored in a freezer to ensure stability.
Analytical Standards for Medicinal and Recreational Cannabis Testing Canadian Cannabis Pesticide Mixes While the legalization of cannabis for both medicinal and recreational purposes has been gaining speed, legislation and regulation has not necessarily kept pace. Out of a drive for self-regulation and significant consumer safety concerns, many producers and manufacturers are turning to testing labs in order to ensure that their products are of high quality and free of chemical contaminants. SPEX CertiPrep offers ISO/IEC 17025 and ISO 17034 Certified Reference Materials (CRMs) for all of the common contaminants such as pesticide residues, residual solvents and heavy metals, as well as qualitative analysis CRMs, such as terpenes. As the industry demands change and regulations are put into place, we continually update our product offering. Designed for Methods: State specific pesticide regulations:
• OAR 333-008-11
• HB 3460
• AOAC 2007-01
• EN 15662 For your convenience, we have designed cannabis pesticide mixes and a kit which contains the 95 compounds that are required to be tested based on regulations set by the Government of Canada. This requirement for mandatory testing for the presence of unauthorized pesticides will help ensure that Canadians can continue to have confidence in obtaining safe, quality-controlled medical cannabis from licensed producers.
Click below for components in individual mixes:
CAN-CAN-1 Canadian Pesticide Mix 1
CAN-CAN-2 Canadian Pesticide Mix 2
CAN-CAN-3 Canadian Pesticide Mix 3
CAN-CAN-4 Canadian Pesticide Mix 4
CAN-CAN-5 Canadian Pesticide Mix 5
CAN-CAN-6 Canadian Pesticide Mix 6
LCS-2650 Dibrom (Naled) Standard
| Component | Concentration | Matrix | CAS# |
|---|---|---|---|
| Aldicarb | 100 µg/mL | LC/MS Acetonitrile | 116-06-3 |
| Baygon (Propoxur) | 100 µg/mL | LC/MS Acetonitrile | 114-26-1 |
| Carbaryl | 100 µg/mL | LC/MS Acetonitrile | 63-25-2 |
| Carbofuran | 100 µg/mL | LC/MS Acetonitrile | 1563-66-2 |
| Fenoxycarb | 100 µg/mL | LC/MS Acetonitrile | 72490-01-8 |
| Imazalil | 100 µg/mL | LC/MS Acetonitrile | 35554-44-0 |
| Imidacloprid | 100 µg/mL | LC/MS Acetonitrile | 138261-41-3 |
| Iprodione | 100 µg/mL | LC/MS Acetonitrile | 36734-19-7 |
| Methiocarb | 100 µg/mL | LC/MS Acetonitrile | 2032-65-7 |
| Methomyl | 100 µg/mL | LC/MS Acetonitrile | 16752-77-5 |
| Novaluron | 100 µg/mL | LC/MS Acetonitrile | 116714-46-6 |
| Oxamyl | 100 µg/mL | LC/MS Acetonitrile | 23135-22-0 |
| Pirimicarb | 100 µg/mL | LC/MS Acetonitrile | 23103-98-2 |
| Thiacloprid | 100 µg/mL | LC/MS Acetonitrile | 111988-49-9 |
| Allethrin | 100 µg/mL | LC/MS Acetonitrile | 584-79-2 |
| Baythroid (Cyfluthrin) | 100 µg/mL | LC/MS Acetonitrile | 68359-37-5 |
| Bifenthrin | 100 µg/mL | LC/MS Acetonitrile | 82657-04-3 |
| Cypermethrin | 100 µg/mL | LC/MS Acetonitrile | 52315-07-8 |
| Deltamethrin | 100 µg/mL | LC/MS Acetonitrile | 52918-63-5 |
| Kinoprene | 100 µg/mL | LC/MS Acetonitrile | 42588-37-4 |
| Methoprene | 100 µg/mL | LC/MS Acetonitrile | 40596-69-8 |
| MGK 264™ | 100 µg/mL | LC/MS Acetonitrile | 113-48-4 |
| Permethrin (mix of cis & trans) | 100 µg/mL | LC/MS Acetonitrile | 52645-53-1 |
| d-Phenothrin (mix of cis & trans) | 100 µg/mL | LC/MS Acetonitrile | 26002-80-2 |
| Piperonyl butoxide | 100 µg/mL | LC/MS Acetonitrile | 51-03-6 |
| Prallethrin (mix of isomers) | 100 µg/mL | LC/MS Acetonitrile | 23031-36-9 |
| Pyrethrins (mix of isomers) | 100 µg/mL | LC/MS Acetonitrile | 8003-34-7 |
| Resmethrin | 100 µg/mL | LC/MS Acetonitrile | 10453-86-8 |
| Sanmarton | 100 µg/mL | LC/MS Acetonitrile | 51630-58-1 |
| Tetramethrin | 100 µg/mL | LC/MS Acetonitrile | 7696-12-0 |
| Azadirachtin | 100 µg/mL | LC/MS Acetonitrile | 11141-17-6 |
| Benzovindiflupyr | 100 µg/mL | LC/MS Acetonitrile | 1072957-71-1 |
| Endosulfan I | 100 µg/mL | LC/MS Acetonitrile | 959-98-8 |
| Endosulfan II | 100 µg/mL | LC/MS Acetonitrile | 33213-65-9 |
| Endosulfan sulfate | 100 µg/mL | LC/MS Acetonitrile | 1031-07-8 |
| Fipronil | 100 µg/mL | LC/MS Acetonitrile | 120068-37-3 |
| Pentachloronitrobenzene | 100 µg/mL | LC/MS Acetonitrile | 82-68-8 |
| Trifloxystrobin | 100 µg/mL | LC/MS Acetonitrile | 141517-21-7 |
| Acephate | 100 µg/mL | LC/MS Acetonitrile | 30560-19-1 |
| Chlorpyrifos | 100 µg/mL | LC/MS Acetonitrile | 2921-88-2 |
| Coumaphos | 100 µg/mL | LC/MS Acetonitrile | 56-72-4 |
| Diazinon | 100 µg/mL | LC/MS Acetonitrile | 333-41-5 |
| Dichlorvos | 100 µg/mL | LC/MS Acetonitrile | 62-73-7 |
| Dimethoate | 100 µg/mL | LC/MS Acetonitrile | 60-51-5 |
| Etofenprox | 100 µg/mL | LC/MS Acetonitrile | 80844-07-1 |
| Etoxazole | 100 µg/mL | LC/MS Acetonitrile | 153233-91-1 |
| Fensulfothion | 100 µg/mL | LC/MS Acetonitrile | 115-90-2 |
| Fenthion | 100 µg/mL | LC/MS Acetonitrile | 55-38-9 |
| Imidan (Phosmet) | 100 µg/mL | LC/MS Acetonitrile | 732-11-6 |
| Malathion | 100 µg/mL | LC/MS Acetonitrile | 121-75-5 |
| Methyl parathion | 100 µg/mL | LC/MS Acetonitrile | 298-00-0 |
| Mevinphos | 100 µg/mL | LC/MS Acetonitrile | 7786-34-7 |
| Prophos | 100 µg/mL | LC/MS Acetonitrile | 13194-48-4 |
| Spiroxamine | 100 µg/mL | LC/MS Acetonitrile | 118134-30-8 |
| Terrazole | 100 µg/mL | LC/MS Acetonitrile | 2593-15-9 |
| Tetrachlorvinphos (Z) | 100 µg/mL | LC/MS Acetonitrile | 22248-79-9 |
| Thiophanate-methyl | 100 µg/mL | LC/MS Acetonitrile | 23564-05-8 |
| Acequinocyl | 100 µg/mL | LC/MS Acetonitrile | 57960-19-7 |
| Acetamiprid | 100 µg/mL | LC/MS Acetonitrile | 135410-20-7 |
| Azoxystrobin | 100 µg/mL | LC/MS Acetonitrile | 131860-33-8 |
| Bifenazate | 100 µg/mL | LC/MS Acetonitrile | 149877-41-8 |
| Boscalid | 100 µg/mL | LC/MS Acetonitrile | 188425-85-6 |
| Buprofezin | 100 µg/mL | LC/MS Acetonitrile | 69327-76-0 |
| Chlorantraniliprole | 100 µg/mL | LC/MS Acetonitrile | 500008-45-7 |
| Chlorfenapyr | 100 µg/mL | LC/MS Acetonitrile | 122453-73-0 |
| Clofentezine | 100 µg/mL | LC/MS Acetonitrile | 74115-24-5 |
| Clothianidin | 100 µg/mL | LC/MS Acetonitrile | 210880-92-5 |
| Cyantraniliprole | 100 µg/mL | LC/MS Acetonitrile | 736994-63-1 |
| Cyprodinil | 100 µg/mL | LC/MS Acetonitrile | 121552-61-2 |
| Dinotefuran | 100 µg/mL | LC/MS Acetonitrile | 165252-70-0 |
| (E)-Fenpyroximate | 100 µg/mL | LC/MS Acetonitrile | 134098-61-6 |
| Flonicamid | 100 µg/mL | LC/MS Acetonitrile | 158062-67-0 |
| Fludioxonil | 100 µg/mL | LC/MS Acetonitrile | 131341-86-1 |
| Fluopyram | 100 µg/mL | LC/MS Acetonitrile | 658066-35-4 |
| Folicur | 100 µg/mL | LC/MS Acetonitrile | 107534-96-3 |
| Hexythiazox | 100 µg/mL | LC/MS Acetonitrile | 78587-05-0 |
| Paclobutrazol | 100 µg/mL | LC/MS Acetonitrile | 76738-62-0 |
| Propiconazole (Tilt) | 100 µg/mL | LC/MS Acetonitrile | 60207-90-1 |
| Pyraclostrobin | 100 µg/mL | LC/MS Acetonitrile | 175013-18-0 |
| Systhane (Myclobutanil) | 100 µg/mL | LC/MS Acetonitrile | 88671-89-0 |
| Tebufenozide | 100 µg/mL | LC/MS Acetonitrile | 112410-23-8 |
| Teflubenzuron | 100 µg/mL | LC/MS Acetonitrile | 83121-18-0 |
| Thiamethoxam | 100 µg/mL | LC/MS Acetonitrile | 153719-23-4 |
| Abamectin | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 71751-41-2 |
| Daminozide | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 1596-84-5 |
| Dodemorph | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 1593-77-7 |
| Kresoxim-methyl | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 143390-89-0 |
| Benzovindiflupyr | 20 μg/mL | LC/MS Acetonitrile | 1072957-71-1 |
| Metalaxyl | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 57837-19-1 |
| Pyridaben | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 96489-71-3 |
| Spinetoram | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 187166-40-1 |
| Spinosad | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 168316-95-8 |
| Spirodiclofen | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 148477-71-8 |
| Spiromesifen | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 283594-90-1 |
| Spirotetramat | 100 µg/mL | LC/MS Acetonitrile:LC/MS Methanol (50:50) | 203313-25-1 |
| Dibrom (Naled) | 1,000 μg/mL | LC/MS Acetonitrile | 300-76-5 |
| Component | CAS # | SMILES Notation | Copy SMILES |
|---|---|---|---|
| Baygon (Propoxur) | 114-26-1 | CNC(=O)Oc1ccccc1OC(C)C | Copy SMILES Notation |
| Carbaryl | 63-25-2 | CNC(=O)Oc1cccc2ccccc12 | Copy SMILES Notation |
| Carbofuran | 1563-66-2 | CNC(=O)Oc1cccc2CC(C)(C)Oc12 | Copy SMILES Notation |
| Fenoxycarb | 72490-01-8 | CCOC(=O)NCCOc1ccc(Oc2ccccc2)cc1 | Copy SMILES Notation |
Safety Data Sheet
Download
